C41H38F3N3O6 — CID 99650047
(2S,4aR,9aS)-N-(2,4-dimethoxyphenyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-[[4-(trifluoromethyl)phenyl]methyl]amino]-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide (PubChem CID 99650047) has the molecular formula C41H38F3N3O6 and a molecular weight of 725.76 g/mol. Its IUPAC name is (2S,4aR,9aS)-N-(2,4-dimethoxyphenyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-[[4-(trifluoromethyl)phenyl]methyl]amino]-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide.
| Compound Name | (2S,4aR,9aS)-N-(2,4-dimethoxyphenyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-[[4-(trifluoromethyl)phenyl]methyl]amino]-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
|---|---|
| PubChem CID | 99650047 |
| Molecular Formula | C41H38F3N3O6 |
| Molecular Weight | 725.76 g/mol |
| Exact Mass | 725.27 |
| IUPAC Name | (2S,4aR,9aS)-N-(2,4-dimethoxyphenyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-[[4-(trifluoromethyl)phenyl]methyl]amino]-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@]2(N(Cc3ccc(C(F)(F)F)cc3)C(=O)CN3C(=O)c4ccccc4C3=O)CC[C@@H]3Cc4ccccc4C[C@H]3C2)c(OC)c1 |
| InChI | InChI=1S/C41H38F3N3O6/c1-52-31-15-16-34(35(21-31)53-2)45-39(51)40(18-17-28-19-26-7-3-4-8-27(26)20-29(28)22-40)47(23-25-11-13-30(14-12-25)41(42,43)44)36(48)24-46-37(49)32-9-5-6-10-33(32)38(46)50/h3-16,21,28-29H,17-20,22-24H2,1-2H3,(H,45,51)/t28-,29+,40+/m1/s1 |
| InChIKey | YGTLRXPEPZGPOK-BINMOFGOSA-N |
| XLogP | 6.94 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.76 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|