C38H40N2O4 — CID 98456053
(2R,4aR,9aS)-2-[benzyl-(2-phenylacetyl)amino]-N-(2,4-dimethoxyphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide (PubChem CID 98456053) has the molecular formula C38H40N2O4 and a molecular weight of 588.75 g/mol. Its IUPAC name is (2R,4aR,9aS)-2-[benzyl-(2-phenylacetyl)amino]-N-(2,4-dimethoxyphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide.
| Compound Name | (2R,4aR,9aS)-2-[benzyl-(2-phenylacetyl)amino]-N-(2,4-dimethoxyphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
|---|---|
| PubChem CID | 98456053 |
| Molecular Formula | C38H40N2O4 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | (2R,4aR,9aS)-2-[benzyl-(2-phenylacetyl)amino]-N-(2,4-dimethoxyphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@]2(N(Cc3ccccc3)C(=O)Cc3ccccc3)CC[C@@H]3Cc4ccccc4C[C@H]3C2)c(OC)c1 |
| InChI | InChI=1S/C38H40N2O4/c1-43-33-17-18-34(35(24-33)44-2)39-37(42)38(20-19-31-22-29-15-9-10-16-30(29)23-32(31)25-38)40(26-28-13-7-4-8-14-28)36(41)21-27-11-5-3-6-12-27/h3-18,24,31-32H,19-23,25-26H2,1-2H3,(H,39,42)/t31-,32+,38-/m1/s1 |
| InChIKey | KVWOOZZINNESRB-ZFDOHDMLSA-N |
| XLogP | 6.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |