C39H39N3O5 — CID 124923591
(2S,4aS,9aS)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(furan-2-ylmethyl)amino]-N-(2,4,6-trimethylphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide (PubChem CID 124923591) has the molecular formula C39H39N3O5 and a molecular weight of 629.76 g/mol. Its IUPAC name is (2S,4aS,9aS)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(furan-2-ylmethyl)amino]-N-(2,4,6-trimethylphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide.
| Compound Name | (2S,4aS,9aS)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(furan-2-ylmethyl)amino]-N-(2,4,6-trimethylphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
|---|---|
| PubChem CID | 124923591 |
| Molecular Formula | C39H39N3O5 |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.29 |
| IUPAC Name | (2S,4aS,9aS)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(furan-2-ylmethyl)amino]-N-(2,4,6-trimethylphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)[C@]2(N(Cc3ccco3)C(=O)CN3C(=O)c4ccccc4C3=O)CC[C@H]3Cc4ccccc4C[C@H]3C2)c(C)c1 |
| InChI | InChI=1S/C39H39N3O5/c1-24-17-25(2)35(26(3)18-24)40-38(46)39(15-14-29-19-27-9-4-5-10-28(27)20-30(29)21-39)42(22-31-11-8-16-47-31)34(43)23-41-36(44)32-12-6-7-13-33(32)37(41)45/h4-13,16-18,29-30H,14-15,19-23H2,1-3H3,(H,40,46)/t29-,30-,39-/m0/s1 |
| InChIKey | QDPMOFUCAIGXIZ-MSVYEENVSA-N |
| XLogP | 6.42 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|