C31H38N2O3 — CID 17037581
(4aR,9aS)-N-(1-adamantyl)-2-[formyl(furan-2-ylmethyl)amino]-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide (PubChem CID 17037581) has the molecular formula C31H38N2O3 and a molecular weight of 486.66 g/mol. Its IUPAC name is (4aR,9aS)-N-(1-adamantyl)-2-[formyl(furan-2-ylmethyl)amino]-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide.
| Compound Name | (4aR,9aS)-N-(1-adamantyl)-2-[formyl(furan-2-ylmethyl)amino]-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
|---|---|
| PubChem CID | 17037581 |
| Molecular Formula | C31H38N2O3 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | (4aR,9aS)-N-(1-adamantyl)-2-[formyl(furan-2-ylmethyl)amino]-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
| SMILES | O=CN(Cc1ccco1)C1(C(=O)NC23CC4CC(CC(C4)C2)C3)CC[C@@H]2Cc3ccccc3C[C@H]2C1 |
| InChI | InChI=1S/C31H38N2O3/c34-20-33(19-28-6-3-9-36-28)31(8-7-26-13-24-4-1-2-5-25(24)14-27(26)18-31)29(35)32-30-15-21-10-22(16-30)12-23(11-21)17-30/h1-6,9,20-23,26-27H,7-8,10-19H2,(H,32,35)/t21?,22?,23?,26-,27+,30?,31?/m1/s1 |
| InChIKey | GWZGSINBVRBAAK-QVIFONKOSA-N |
| XLogP | 5.28 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|