C39H42N2O2 — CID 2716543
(2S,4aS,9aR)-2-[benzyl-(2-phenylacetyl)amino]-N-(2,4,6-trimethylphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide (PubChem CID 2716543) has the molecular formula C39H42N2O2 and a molecular weight of 570.78 g/mol. Its IUPAC name is (2S,4aS,9aR)-2-[benzyl-(2-phenylacetyl)amino]-N-(2,4,6-trimethylphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide.
| Compound Name | (2S,4aS,9aR)-2-[benzyl-(2-phenylacetyl)amino]-N-(2,4,6-trimethylphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
|---|---|
| PubChem CID | 2716543 |
| Molecular Formula | C39H42N2O2 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | (2S,4aS,9aR)-2-[benzyl-(2-phenylacetyl)amino]-N-(2,4,6-trimethylphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)[C@]2(N(Cc3ccccc3)C(=O)Cc3ccccc3)CC[C@H]3Cc4ccccc4C[C@@H]3C2)c(C)c1 |
| InChI | InChI=1S/C39H42N2O2/c1-27-20-28(2)37(29(3)21-27)40-38(43)39(19-18-34-23-32-16-10-11-17-33(32)24-35(34)25-39)41(26-31-14-8-5-9-15-31)36(42)22-30-12-6-4-7-13-30/h4-17,20-21,34-35H,18-19,22-26H2,1-3H3,(H,40,43)/t34-,35+,39-/m0/s1 |
| InChIKey | SDZGLDHACQERAK-GEPWALDNSA-N |
| XLogP | 7.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |