C34H34N4O6 — CID 121238277
N-(2,4-dimethoxyphenyl)-1-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-[2-(1H-indol-3-yl)ethyl]amino]cyclopentane-1-carboxamide (PubChem CID 121238277) has the molecular formula C34H34N4O6 and a molecular weight of 594.67 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-1-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-[2-(1H-indol-3-yl)ethyl]amino]cyclopentane-1-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-1-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-[2-(1H-indol-3-yl)ethyl]amino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 121238277 |
| Molecular Formula | C34H34N4O6 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-1-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-[2-(1H-indol-3-yl)ethyl]amino]cyclopentane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(N(CCc3c[nH]c4ccccc34)C(=O)CN3C(=O)c4ccccc4C3=O)CCCC2)c(OC)c1 |
| InChI | InChI=1S/C34H34N4O6/c1-43-23-13-14-28(29(19-23)44-2)36-33(42)34(16-7-8-17-34)38(18-15-22-20-35-27-12-6-5-9-24(22)27)30(39)21-37-31(40)25-10-3-4-11-26(25)32(37)41/h3-6,9-14,19-20,35H,7-8,15-18,21H2,1-2H3,(H,36,42) |
| InChIKey | YFBUKWCRTWRCSB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 121.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|