C32H31N5O4S — CID 121238320
4-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-[2-(1H-indol-3-yl)ethyl]amino]-N-(pyridin-3-ylmethyl)thiane-4-carboxamide (PubChem CID 121238320) has the molecular formula C32H31N5O4S and a molecular weight of 581.70 g/mol. Its IUPAC name is 4-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-[2-(1H-indol-3-yl)ethyl]amino]-N-(pyridin-3-ylmethyl)thiane-4-carboxamide.
| Compound Name | 4-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-[2-(1H-indol-3-yl)ethyl]amino]-N-(pyridin-3-ylmethyl)thiane-4-carboxamide |
|---|---|
| PubChem CID | 121238320 |
| Molecular Formula | C32H31N5O4S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | 4-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-[2-(1H-indol-3-yl)ethyl]amino]-N-(pyridin-3-ylmethyl)thiane-4-carboxamide |
| SMILES | O=C1c2ccccc2C(=O)N1CC(=O)N(CCc1c[nH]c2ccccc12)C1(C(=O)NCc2cccnc2)CCSCC1 |
| InChI | InChI=1S/C32H31N5O4S/c38-28(21-36-29(39)25-8-1-2-9-26(25)30(36)40)37(15-11-23-20-34-27-10-4-3-7-24(23)27)32(12-16-42-17-13-32)31(41)35-19-22-6-5-14-33-18-22/h1-10,14,18,20,34H,11-13,15-17,19,21H2,(H,35,41) |
| InChIKey | AOHKZEHTGKHOID-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|