C33H33FN4O5 — CID 43820154
1-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)cyclopentane-1-carboxamide (PubChem CID 43820154) has the molecular formula C33H33FN4O5 and a molecular weight of 584.65 g/mol. Its IUPAC name is 1-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)cyclopentane-1-carboxamide.
| Compound Name | 1-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 43820154 |
| Molecular Formula | C33H33FN4O5 |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | 1-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)cyclopentane-1-carboxamide |
| SMILES | O=C1C(=O)N(CC(=O)N(Cc2ccc(F)cc2)C2(C(=O)Nc3ccc(N4CCOCC4)cc3)CCCC2)c2ccccc21 |
| InChI | InChI=1S/C33H33FN4O5/c34-24-9-7-23(8-10-24)21-38(29(39)22-37-28-6-2-1-5-27(28)30(40)31(37)41)33(15-3-4-16-33)32(42)35-25-11-13-26(14-12-25)36-17-19-43-20-18-36/h1-2,5-14H,3-4,15-22H2,(H,35,42) |
| InChIKey | CFIDJHNMCHDFNJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|