C36H33ClN4O5 — CID 43820051
2-(4-chlorophenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 43820051) has the molecular formula C36H33ClN4O5 and a molecular weight of 637.14 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 43820051 |
| Molecular Formula | C36H33ClN4O5 |
| Molecular Weight | 637.14 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | 2-(4-chlorophenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1ccc(CN(C(=O)CN2C(=O)C(=O)c3ccccc32)C(C(=O)Nc2ccc(N3CCOCC3)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C36H33ClN4O5/c1-24-6-8-25(9-7-24)22-41(32(42)23-40-31-5-3-2-4-30(31)34(43)36(40)45)33(26-10-12-27(37)13-11-26)35(44)38-28-14-16-29(17-15-28)39-18-20-46-21-19-39/h2-17,33H,18-23H2,1H3,(H,38,44) |
| InChIKey | ATQLLHUOTYQEGZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.14 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|