C28H27ClN4O4 — CID 43819630
2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]propanamide (PubChem CID 43819630) has the molecular formula C28H27ClN4O4 and a molecular weight of 519.00 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]propanamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 43819630 |
| Molecular Formula | C28H27ClN4O4 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(N(C)C)cc1)N(Cc1ccc(Cl)cc1)C(=O)CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C28H27ClN4O4/c1-18(27(36)30-21-12-14-22(15-13-21)31(2)3)32(16-19-8-10-20(29)11-9-19)25(34)17-33-24-7-5-4-6-23(24)26(35)28(33)37/h4-15,18H,16-17H2,1-3H3,(H,30,36) |
| InChIKey | ZNLPJOTVQFTNKD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|