C29H29N3O6 — CID 2717855
(2S)-N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]propanamide (PubChem CID 2717855) has the molecular formula C29H29N3O6 and a molecular weight of 515.57 g/mol. Its IUPAC name is (2S)-N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]propanamide.
| Compound Name | (2S)-N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 2717855 |
| Molecular Formula | C29H29N3O6 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | (2S)-N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]propanamide |
| SMILES | COc1ccc(NC(=O)[C@H](C)N(Cc2ccccc2C)C(=O)CN2C(=O)C(=O)c3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C29H29N3O6/c1-18-9-5-6-10-20(18)16-31(19(2)28(35)30-23-14-13-21(37-3)15-25(23)38-4)26(33)17-32-24-12-8-7-11-22(24)27(34)29(32)36/h5-15,19H,16-17H2,1-4H3,(H,30,35)/t19-/m0/s1 |
| InChIKey | XIKLRVCFVMYUHA-IBGZPJMESA-N |
| XLogP | 3.60 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|