C31H36ClN5O2S — CID 43821652
2-[(4-chlorophenyl)methyl-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-2-cyclohex-3-en-1-yl-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 43821652) has the molecular formula C31H36ClN5O2S and a molecular weight of 578.18 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-2-cyclohex-3-en-1-yl-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-2-cyclohex-3-en-1-yl-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 43821652 |
| Molecular Formula | C31H36ClN5O2S |
| Molecular Weight | 578.18 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]-2-cyclohex-3-en-1-yl-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | Cc1cc(C)nc(SCC(=O)N(Cc2ccc(Cl)cc2)C(C(=O)Nc2ccc(N(C)C)cc2)C2CC=CCC2)n1 |
| InChI | InChI=1S/C31H36ClN5O2S/c1-21-18-22(2)34-31(33-21)40-20-28(38)37(19-23-10-12-25(32)13-11-23)29(24-8-6-5-7-9-24)30(39)35-26-14-16-27(17-15-26)36(3)4/h5-6,10-18,24,29H,7-9,19-20H2,1-4H3,(H,35,39) |
| InChIKey | QIWXVRIAOHTKGP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.18 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|