C34H41N5O4S — CID 43822058
2-cyclohex-3-en-1-yl-2-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-[(4-methoxyphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 43822058) has the molecular formula C34H41N5O4S and a molecular weight of 615.80 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-2-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-[(4-methoxyphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-cyclohex-3-en-1-yl-2-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-[(4-methoxyphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 43822058 |
| Molecular Formula | C34H41N5O4S |
| Molecular Weight | 615.80 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-2-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-[(4-methoxyphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1ccc(CN(C(=O)CSc2nc(C)cc(C)n2)C(C(=O)Nc2ccc(N3CCOCC3)cc2)C2CC=CCC2)cc1 |
| InChI | InChI=1S/C34H41N5O4S/c1-24-21-25(2)36-34(35-24)44-23-31(40)39(22-26-9-15-30(42-3)16-10-26)32(27-7-5-4-6-8-27)33(41)37-28-11-13-29(14-12-28)38-17-19-43-20-18-38/h4-5,9-16,21,27,32H,6-8,17-20,22-23H2,1-3H3,(H,37,41) |
| InChIKey | IBTQUJLTEXDGTC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.80 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|