C29H30N4O2S — CID 43821002
N-[4-(dimethylamino)phenyl]-2-[(2-phenylacetyl)-[(4-phenyl-1,3-thiazol-2-yl)methyl]amino]propanamide (PubChem CID 43821002) has the molecular formula C29H30N4O2S and a molecular weight of 498.65 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[(2-phenylacetyl)-[(4-phenyl-1,3-thiazol-2-yl)methyl]amino]propanamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[(2-phenylacetyl)-[(4-phenyl-1,3-thiazol-2-yl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 43821002 |
| Molecular Formula | C29H30N4O2S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[(2-phenylacetyl)-[(4-phenyl-1,3-thiazol-2-yl)methyl]amino]propanamide |
| SMILES | CC(C(=O)Nc1ccc(N(C)C)cc1)N(Cc1nc(-c2ccccc2)cs1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C29H30N4O2S/c1-21(29(35)30-24-14-16-25(17-15-24)32(2)3)33(28(34)18-22-10-6-4-7-11-22)19-27-31-26(20-36-27)23-12-8-5-9-13-23/h4-17,20-21H,18-19H2,1-3H3,(H,30,35) |
| InChIKey | DVNYVUHAJQCLAM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|