C30H31NO3 — CID 42704361
N-butan-2-yl-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]naphthalene-1-carboxamide (PubChem CID 42704361) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is N-butan-2-yl-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]naphthalene-1-carboxamide.
| Compound Name | N-butan-2-yl-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 42704361 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | N-butan-2-yl-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]naphthalene-1-carboxamide |
| SMILES | CCC(C)N(Cc1ccc(OCc2ccccc2)c(OC)c1)C(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H31NO3/c1-4-22(2)31(30(32)27-16-10-14-25-13-8-9-15-26(25)27)20-24-17-18-28(29(19-24)33-3)34-21-23-11-6-5-7-12-23/h5-19,22H,4,20-21H2,1-3H3 |
| InChIKey | LNUGLCPCEWIBCV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |