C29H28N2O4 — CID 55549663
methyl 3-[2-[3-[[3-methyl-2-[(2-phenylacetyl)amino]butanoyl]amino]phenyl]ethynyl]benzoate (PubChem CID 55549663) has the molecular formula C29H28N2O4 and a molecular weight of 468.55 g/mol. Its IUPAC name is methyl 3-[2-[3-[[3-methyl-2-[(2-phenylacetyl)amino]butanoyl]amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[[3-methyl-2-[(2-phenylacetyl)amino]butanoyl]amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 55549663 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | methyl 3-[2-[3-[[3-methyl-2-[(2-phenylacetyl)amino]butanoyl]amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)C(NC(=O)Cc3ccccc3)C(C)C)c2)c1 |
| InChI | InChI=1S/C29H28N2O4/c1-20(2)27(31-26(32)19-21-9-5-4-6-10-21)28(33)30-25-14-8-12-23(18-25)16-15-22-11-7-13-24(17-22)29(34)35-3/h4-14,17-18,20,27H,19H2,1-3H3,(H,30,33)(H,31,32) |
| InChIKey | KHFGMLSLQOEPJK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|