C20H18F2N2O5 — CID 42944601
methyl 2,4-difluoro-5-[[3-(oxolane-2-carbonylamino)benzoyl]amino]benzoate (PubChem CID 42944601) has the molecular formula C20H18F2N2O5 and a molecular weight of 404.37 g/mol. Its IUPAC name is methyl 2,4-difluoro-5-[[3-(oxolane-2-carbonylamino)benzoyl]amino]benzoate.
| Compound Name | methyl 2,4-difluoro-5-[[3-(oxolane-2-carbonylamino)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 42944601 |
| Molecular Formula | C20H18F2N2O5 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | methyl 2,4-difluoro-5-[[3-(oxolane-2-carbonylamino)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2cccc(NC(=O)C3CCCO3)c2)c(F)cc1F |
| InChI | InChI=1S/C20H18F2N2O5/c1-28-20(27)13-9-16(15(22)10-14(13)21)24-18(25)11-4-2-5-12(8-11)23-19(26)17-6-3-7-29-17/h2,4-5,8-10,17H,3,6-7H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | WGKGQINQOVCBNM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |