C15H10BrF2NO3 — CID 46539881
methyl 5-[(3-bromobenzoyl)amino]-2,4-difluorobenzoate (PubChem CID 46539881) has the molecular formula C15H10BrF2NO3 and a molecular weight of 370.15 g/mol. Its IUPAC name is methyl 5-[(3-bromobenzoyl)amino]-2,4-difluorobenzoate.
| Compound Name | methyl 5-[(3-bromobenzoyl)amino]-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 46539881 |
| Molecular Formula | C15H10BrF2NO3 |
| Molecular Weight | 370.15 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | methyl 5-[(3-bromobenzoyl)amino]-2,4-difluorobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2cccc(Br)c2)c(F)cc1F |
| InChI | InChI=1S/C15H10BrF2NO3/c1-22-15(21)10-6-13(12(18)7-11(10)17)19-14(20)8-3-2-4-9(16)5-8/h2-7H,1H3,(H,19,20) |
| InChIKey | RNWMDKIJGYAUPN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.15 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |