C21H19NO — CID 146488931
(1R)-N-naphthalen-1-yl-2-phenylcyclobutane-1-carboxamide (PubChem CID 146488931) has the molecular formula C21H19NO and a molecular weight of 301.39 g/mol. Its IUPAC name is (1R)-N-naphthalen-1-yl-2-phenylcyclobutane-1-carboxamide.
| Compound Name | (1R)-N-naphthalen-1-yl-2-phenylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 146488931 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (1R)-N-naphthalen-1-yl-2-phenylcyclobutane-1-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)[C@@H]1CCC1c1ccccc1 |
| InChI | InChI=1S/C21H19NO/c23-21(19-14-13-17(19)15-7-2-1-3-8-15)22-20-12-6-10-16-9-4-5-11-18(16)20/h1-12,17,19H,13-14H2,(H,22,23)/t17?,19-/m1/s1 |
| InChIKey | STTGXEVDRWPEDQ-WHCXFUJUSA-N |
| XLogP | 4.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |