C22H22N2O — CID 158761407
(3S,4R)-N-(7-methylnaphthalen-1-yl)-4-phenylpyrrolidine-3-carboxamide (PubChem CID 158761407) has the molecular formula C22H22N2O and a molecular weight of 330.43 g/mol. Its IUPAC name is (3S,4R)-N-(7-methylnaphthalen-1-yl)-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-N-(7-methylnaphthalen-1-yl)-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 158761407 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (3S,4R)-N-(7-methylnaphthalen-1-yl)-4-phenylpyrrolidine-3-carboxamide |
| SMILES | Cc1ccc2cccc(NC(=O)[C@@H]3CNC[C@H]3c3ccccc3)c2c1 |
| InChI | InChI=1S/C22H22N2O/c1-15-10-11-17-8-5-9-21(18(17)12-15)24-22(25)20-14-23-13-19(20)16-6-3-2-4-7-16/h2-12,19-20,23H,13-14H2,1H3,(H,24,25)/t19-,20+/m0/s1 |
| InChIKey | IOSIWVKYYYEEOV-VQTJNVASSA-N |
| XLogP | 4.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |