C20H18FN3O — CID 156839080
(3R,4S)-4-(4-fluorophenyl)-N-isoquinolin-5-ylpyrrolidine-3-carboxamide (PubChem CID 156839080) has the molecular formula C20H18FN3O and a molecular weight of 335.38 g/mol. Its IUPAC name is (3R,4S)-4-(4-fluorophenyl)-N-isoquinolin-5-ylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-4-(4-fluorophenyl)-N-isoquinolin-5-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 156839080 |
| Molecular Formula | C20H18FN3O |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (3R,4S)-4-(4-fluorophenyl)-N-isoquinolin-5-ylpyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc2cnccc12)[C@H]1CNC[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H18FN3O/c21-15-6-4-13(5-7-15)17-11-23-12-18(17)20(25)24-19-3-1-2-14-10-22-9-8-16(14)19/h1-10,17-18,23H,11-12H2,(H,24,25)/t17-,18+/m1/s1 |
| InChIKey | SYEQIZLJXKMXGI-MSOLQXFVSA-N |
| XLogP | 3.32 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |