C18H19Cl2N3OS — CID 162471099
N-isoquinolin-5-yl-4-thiophen-2-ylpyrrolidine-3-carboxamide;dihydrochloride (PubChem CID 162471099) has the molecular formula C18H19Cl2N3OS and a molecular weight of 396.34 g/mol. Its IUPAC name is N-isoquinolin-5-yl-4-thiophen-2-ylpyrrolidine-3-carboxamide;dihydrochloride.
| Compound Name | N-isoquinolin-5-yl-4-thiophen-2-ylpyrrolidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 162471099 |
| Molecular Formula | C18H19Cl2N3OS |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | N-isoquinolin-5-yl-4-thiophen-2-ylpyrrolidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1cccc2cnccc12)C1CNCC1c1cccs1 |
| InChI | InChI=1S/C18H17N3OS.2ClH/c22-18(15-11-20-10-14(15)17-5-2-8-23-17)21-16-4-1-3-12-9-19-7-6-13(12)16;;/h1-9,14-15,20H,10-11H2,(H,21,22);2*1H |
| InChIKey | RODHSYOWIOSMEI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |