C17H16N4OS — CID 162470972
(3R,4R)-N-isoquinolin-5-yl-4-(1,3-thiazol-2-yl)pyrrolidine-3-carboxamide (PubChem CID 162470972) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is (3R,4R)-N-isoquinolin-5-yl-4-(1,3-thiazol-2-yl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N-isoquinolin-5-yl-4-(1,3-thiazol-2-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 162470972 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (3R,4R)-N-isoquinolin-5-yl-4-(1,3-thiazol-2-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc2cnccc12)[C@H]1CNC[C@@H]1c1nccs1 |
| InChI | InChI=1S/C17H16N4OS/c22-16(13-9-19-10-14(13)17-20-6-7-23-17)21-15-3-1-2-11-8-18-5-4-12(11)15/h1-8,13-14,19H,9-10H2,(H,21,22)/t13-,14-/m0/s1 |
| InChIKey | KFLQMJZQLCPPGZ-KBPBESRZSA-N |
| XLogP | 2.63 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |