C18H18N4OS2 — CID 156839141
S-[[(4S)-4-(1,3-thiazol-2-yl)pyrrolidin-3-yl]methyl] N-isoquinolin-5-ylcarbamothioate (PubChem CID 156839141) has the molecular formula C18H18N4OS2 and a molecular weight of 370.50 g/mol. Its IUPAC name is S-[[(4S)-4-(1,3-thiazol-2-yl)pyrrolidin-3-yl]methyl] N-isoquinolin-5-ylcarbamothioate.
| Compound Name | S-[[(4S)-4-(1,3-thiazol-2-yl)pyrrolidin-3-yl]methyl] N-isoquinolin-5-ylcarbamothioate |
|---|---|
| PubChem CID | 156839141 |
| Molecular Formula | C18H18N4OS2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | S-[[(4S)-4-(1,3-thiazol-2-yl)pyrrolidin-3-yl]methyl] N-isoquinolin-5-ylcarbamothioate |
| SMILES | O=C(Nc1cccc2cnccc12)SCC1CNC[C@H]1c1nccs1 |
| InChI | InChI=1S/C18H18N4OS2/c23-18(22-16-3-1-2-12-8-19-5-4-14(12)16)25-11-13-9-20-10-15(13)17-21-6-7-24-17/h1-8,13,15,20H,9-11H2,(H,22,23)/t13?,15-/m1/s1 |
| InChIKey | BFMTYZVBNOIMNE-AWKYBWMHSA-N |
| XLogP | 3.96 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|