C24H27NO — CID 7271639
(1S,4Z,8E,12S)-N-naphthalen-1-ylbicyclo[10.1.0]trideca-4,8-diene-13-carboxamide (PubChem CID 7271639) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is (1S,4Z,8E,12S)-N-naphthalen-1-ylbicyclo[10.1.0]trideca-4,8-diene-13-carboxamide.
| Compound Name | (1S,4Z,8E,12S)-N-naphthalen-1-ylbicyclo[10.1.0]trideca-4,8-diene-13-carboxamide |
|---|---|
| PubChem CID | 7271639 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (1S,4Z,8E,12S)-N-naphthalen-1-ylbicyclo[10.1.0]trideca-4,8-diene-13-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)C1[C@H]2CC/C=C\CC/C=C/CC[C@H]12 |
| InChI | InChI=1S/C24H27NO/c26-24(25-22-17-11-13-18-12-9-10-14-19(18)22)23-20-15-7-5-3-1-2-4-6-8-16-21(20)23/h3-6,9-14,17,20-21,23H,1-2,7-8,15-16H2,(H,25,26)/b5-3-,6-4+/t20-,21-,23?/m0/s1 |
| InChIKey | LDWOCVLKNFPNQW-ONTZPFSDSA-N |
| XLogP | 6.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|