C14H20OS2 — CID 79972858
1-(1,4-dithian-2-yl)-4-phenylbutan-1-ol (PubChem CID 79972858) has the molecular formula C14H20OS2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-4-phenylbutan-1-ol.
| Compound Name | 1-(1,4-dithian-2-yl)-4-phenylbutan-1-ol |
|---|---|
| PubChem CID | 79972858 |
| Molecular Formula | C14H20OS2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-4-phenylbutan-1-ol |
| SMILES | OC(CCCc1ccccc1)C1CSCCS1 |
| InChI | InChI=1S/C14H20OS2/c15-13(14-11-16-9-10-17-14)8-4-7-12-5-2-1-3-6-12/h1-3,5-6,13-15H,4,7-11H2 |
| InChIKey | BOZDIFGFVZNJJW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |