C18H20OS — CID 105091347
1-(2,3-dihydro-1-benzothiophen-3-yl)-4-phenylbutan-1-ol (PubChem CID 105091347) has the molecular formula C18H20OS and a molecular weight of 284.42 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-3-yl)-4-phenylbutan-1-ol.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)-4-phenylbutan-1-ol |
|---|---|
| PubChem CID | 105091347 |
| Molecular Formula | C18H20OS |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)-4-phenylbutan-1-ol |
| SMILES | OC(CCCc1ccccc1)C1CSc2ccccc21 |
| InChI | InChI=1S/C18H20OS/c19-17(11-6-9-14-7-2-1-3-8-14)16-13-20-18-12-5-4-10-15(16)18/h1-5,7-8,10,12,16-17,19H,6,9,11,13H2 |
| InChIKey | RIRJGFUPHAMSCN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |