C16H15BrOS — CID 105077495
2-(4-bromophenyl)-1-(2,3-dihydro-1-benzothiophen-3-yl)ethanol (PubChem CID 105077495) has the molecular formula C16H15BrOS and a molecular weight of 335.27 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(2,3-dihydro-1-benzothiophen-3-yl)ethanol.
| Compound Name | 2-(4-bromophenyl)-1-(2,3-dihydro-1-benzothiophen-3-yl)ethanol |
|---|---|
| PubChem CID | 105077495 |
| Molecular Formula | C16H15BrOS |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-(4-bromophenyl)-1-(2,3-dihydro-1-benzothiophen-3-yl)ethanol |
| SMILES | OC(Cc1ccc(Br)cc1)C1CSc2ccccc21 |
| InChI | InChI=1S/C16H15BrOS/c17-12-7-5-11(6-8-12)9-15(18)14-10-19-16-4-2-1-3-13(14)16/h1-8,14-15,18H,9-10H2 |
| InChIKey | JYVDCNMTNJFHQO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |