C9H14N4S2 — CID 105249199
[1,4-dithian-2-yl(pyrimidin-5-yl)methyl]hydrazine (PubChem CID 105249199) has the molecular formula C9H14N4S2 and a molecular weight of 242.37 g/mol. Its IUPAC name is [1,4-dithian-2-yl(pyrimidin-5-yl)methyl]hydrazine.
| Compound Name | [1,4-dithian-2-yl(pyrimidin-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105249199 |
| Molecular Formula | C9H14N4S2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | [1,4-dithian-2-yl(pyrimidin-5-yl)methyl]hydrazine |
| SMILES | NNC(c1cncnc1)C1CSCCS1 |
| InChI | InChI=1S/C9H14N4S2/c10-13-9(7-3-11-6-12-4-7)8-5-14-1-2-15-8/h3-4,6,8-9,13H,1-2,5,10H2 |
| InChIKey | NOHAUMYJRPCMDU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|