C12H18N2OS2 — CID 105249296
[1,4-dithian-2-yl-(4-methoxyphenyl)methyl]hydrazine (PubChem CID 105249296) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is [1,4-dithian-2-yl-(4-methoxyphenyl)methyl]hydrazine.
| Compound Name | [1,4-dithian-2-yl-(4-methoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105249296 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | [1,4-dithian-2-yl-(4-methoxyphenyl)methyl]hydrazine |
| SMILES | COc1ccc(C(NN)C2CSCCS2)cc1 |
| InChI | InChI=1S/C12H18N2OS2/c1-15-10-4-2-9(3-5-10)12(14-13)11-8-16-6-7-17-11/h2-5,11-12,14H,6-8,13H2,1H3 |
| InChIKey | RHTHLIRENJNIQD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|