C10H19N5S2 — CID 105249262
[1,4-dithian-2-yl-(3-propyltriazol-4-yl)methyl]hydrazine (PubChem CID 105249262) has the molecular formula C10H19N5S2 and a molecular weight of 273.43 g/mol. Its IUPAC name is [1,4-dithian-2-yl-(3-propyltriazol-4-yl)methyl]hydrazine.
| Compound Name | [1,4-dithian-2-yl-(3-propyltriazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105249262 |
| Molecular Formula | C10H19N5S2 |
| Molecular Weight | 273.43 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | [1,4-dithian-2-yl-(3-propyltriazol-4-yl)methyl]hydrazine |
| SMILES | CCCn1nncc1C(NN)C1CSCCS1 |
| InChI | InChI=1S/C10H19N5S2/c1-2-3-15-8(6-12-14-15)10(13-11)9-7-16-4-5-17-9/h6,9-10,13H,2-5,7,11H2,1H3 |
| InChIKey | MPQZEEAFZWRYCZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|