C14H27N5S — CID 106445341
N-[(4-methylthiomorpholin-3-yl)-(3-propyltriazol-4-yl)methyl]propan-1-amine (PubChem CID 106445341) has the molecular formula C14H27N5S and a molecular weight of 297.47 g/mol. Its IUPAC name is N-[(4-methylthiomorpholin-3-yl)-(3-propyltriazol-4-yl)methyl]propan-1-amine.
| Compound Name | N-[(4-methylthiomorpholin-3-yl)-(3-propyltriazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106445341 |
| Molecular Formula | C14H27N5S |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | N-[(4-methylthiomorpholin-3-yl)-(3-propyltriazol-4-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cnnn1CCC)C1CSCCN1C |
| InChI | InChI=1S/C14H27N5S/c1-4-6-15-14(13-11-20-9-8-18(13)3)12-10-16-17-19(12)7-5-2/h10,13-15H,4-9,11H2,1-3H3 |
| InChIKey | SIYZNQWTHTTXLE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |