C14H24N4S2 — CID 105249246
[2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dithian-2-yl)ethyl]hydrazine (PubChem CID 105249246) has the molecular formula C14H24N4S2 and a molecular weight of 312.51 g/mol. Its IUPAC name is [2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dithian-2-yl)ethyl]hydrazine.
| Compound Name | [2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dithian-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105249246 |
| Molecular Formula | C14H24N4S2 |
| Molecular Weight | 312.51 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dithian-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccn(C2CCCC2)n1)C1CSCCS1 |
| InChI | InChI=1S/C14H24N4S2/c15-16-13(14-10-19-7-8-20-14)9-11-5-6-18(17-11)12-3-1-2-4-12/h5-6,12-14,16H,1-4,7-10,15H2 |
| InChIKey | HYULJYAYMUFFBR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|