C13H19ClN2O2S — CID 105283336
[2-(4-chlorophenyl)-1-(1,1-dioxothian-2-yl)ethyl]hydrazine (PubChem CID 105283336) has the molecular formula C13H19ClN2O2S and a molecular weight of 302.83 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-1-(1,1-dioxothian-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-chlorophenyl)-1-(1,1-dioxothian-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105283336 |
| Molecular Formula | C13H19ClN2O2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [2-(4-chlorophenyl)-1-(1,1-dioxothian-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)cc1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H19ClN2O2S/c14-11-6-4-10(5-7-11)9-12(16-15)13-3-1-2-8-19(13,17)18/h4-7,12-13,16H,1-3,8-9,15H2 |
| InChIKey | WLSQPVMWTZYWFA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|