C28H24Cl2N2O5S — CID 66616761
[3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-phenylphenyl)methyl]amino]methyl]phenyl]methylcarbamic acid (PubChem CID 66616761) has the molecular formula C28H24Cl2N2O5S and a molecular weight of 571.48 g/mol. Its IUPAC name is [3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-phenylphenyl)methyl]amino]methyl]phenyl]methylcarbamic acid.
| Compound Name | [3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-phenylphenyl)methyl]amino]methyl]phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 66616761 |
| Molecular Formula | C28H24Cl2N2O5S |
| Molecular Weight | 571.48 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | [3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-phenylphenyl)methyl]amino]methyl]phenyl]methylcarbamic acid |
| SMILES | O=C(O)NCc1cccc(CN(Cc2ccc(-c3ccccc3)cc2)S(=O)(=O)c2cc(Cl)cc(Cl)c2O)c1 |
| InChI | InChI=1S/C28H24Cl2N2O5S/c29-24-14-25(30)27(33)26(15-24)38(36,37)32(18-21-6-4-5-20(13-21)16-31-28(34)35)17-19-9-11-23(12-10-19)22-7-2-1-3-8-22/h1-15,31,33H,16-18H2,(H,34,35) |
| InChIKey | GMRJPFZKKJLONQ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|