C25H36N3O11PS — CID 142035270
[(3S)-oxolan-3-yl] N-[4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate;phosphoric acid (PubChem CID 142035270) has the molecular formula C25H36N3O11PS and a molecular weight of 617.61 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] N-[4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate;phosphoric acid.
| Compound Name | [(3S)-oxolan-3-yl] N-[4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate;phosphoric acid |
|---|---|
| PubChem CID | 142035270 |
| Molecular Formula | C25H36N3O11PS |
| Molecular Weight | 617.61 g/mol |
| Exact Mass | 617.18 |
| IUPAC Name | [(3S)-oxolan-3-yl] N-[4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate;phosphoric acid |
| SMILES | CC(C)CN(CCC(Cc1ccccc1)NC(=O)O[C@H]1CCOC1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1.O=P(O)(O)O |
| InChI | InChI=1S/C25H33N3O7S.H3O4P/c1-19(2)17-27(36(32,33)24-10-8-22(9-11-24)28(30)31)14-12-21(16-20-6-4-3-5-7-20)26-25(29)35-23-13-15-34-18-23;1-5(2,3)4/h3-11,19,21,23H,12-18H2,1-2H3,(H,26,29);(H3,1,2,3,4)/t21?,23-;/m0./s1 |
| InChIKey | JJMPFZRCSGGNNV-RLDJWPNBSA-N |
| XLogP | 2.83 |
| TPSA | 205.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.61 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|