C18H27N3O6S — CID 11047928
[(3S)-oxolan-3-yl] N-[3-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-2-oxopropyl]carbamate (PubChem CID 11047928) has the molecular formula C18H27N3O6S and a molecular weight of 413.50 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] N-[3-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-2-oxopropyl]carbamate.
| Compound Name | [(3S)-oxolan-3-yl] N-[3-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-2-oxopropyl]carbamate |
|---|---|
| PubChem CID | 11047928 |
| Molecular Formula | C18H27N3O6S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [(3S)-oxolan-3-yl] N-[3-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-2-oxopropyl]carbamate |
| SMILES | CC(C)CN(CC(=O)CNC(=O)O[C@H]1CCOC1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H27N3O6S/c1-13(2)10-21(28(24,25)17-5-3-14(19)4-6-17)11-15(22)9-20-18(23)27-16-7-8-26-12-16/h3-6,13,16H,7-12,19H2,1-2H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | BNEDAKBUBIKANV-INIZCTEOSA-N |
| XLogP | 1.00 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|