C27H38N4O6S — CID 58853129
[(6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] N-[(2S,3R)-4-[(5-amino-3-pyridinyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 58853129) has the molecular formula C27H38N4O6S and a molecular weight of 546.69 g/mol. Its IUPAC name is [(6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] N-[(2S,3R)-4-[(5-amino-3-pyridinyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] N-[(2S,3R)-4-[(5-amino-3-pyridinyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58853129 |
| Molecular Formula | C27H38N4O6S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | [(6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] N-[(2S,3R)-4-[(5-amino-3-pyridinyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1CC2CCO[C@@H]2C1)S(=O)(=O)c1cncc(N)c1 |
| InChI | InChI=1S/C27H38N4O6S/c1-18(2)16-31(38(34,35)23-12-21(28)14-29-15-23)17-25(32)24(10-19-6-4-3-5-7-19)30-27(33)37-22-11-20-8-9-36-26(20)13-22/h3-7,12,14-15,18,20,22,24-26,32H,8-11,13,16-17,28H2,1-2H3,(H,30,33)/t20?,22?,24-,25+,26+/m0/s1 |
| InChIKey | DATMUTOFBXEYJB-IPHLTJJTSA-N |
| XLogP | 2.58 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |