C30H42N2O8S — CID 129190049
(3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-5-yl) N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 129190049) has the molecular formula C30H42N2O8S and a molecular weight of 590.74 g/mol. Its IUPAC name is (3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-5-yl) N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | (3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-5-yl) N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 129190049 |
| Molecular Formula | C30H42N2O8S |
| Molecular Weight | 590.74 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | (3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-5-yl) N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COC3OCC(C)C3C2)cc1 |
| InChI | InChI=1S/C30H42N2O8S/c1-20(2)16-32(41(35,36)25-12-10-23(37-4)11-13-25)17-28(33)27(14-22-8-6-5-7-9-22)31-30(34)40-24-15-26-21(3)18-38-29(26)39-19-24/h5-13,20-21,24,26-29,33H,14-19H2,1-4H3,(H,31,34)/t21?,24?,26?,27-,28+,29?/m0/s1 |
| InChIKey | JLUPJJIXLYLHHS-ZWYMGSBQSA-N |
| XLogP | 3.44 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.74 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |