C30H40N2O9S — CID 56929731
[(1R,2R,6R,8R,10R)-3,7,9-trioxatricyclo[6.3.0.02,6]undecan-10-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 56929731) has the molecular formula C30H40N2O9S and a molecular weight of 604.72 g/mol. Its IUPAC name is [(1R,2R,6R,8R,10R)-3,7,9-trioxatricyclo[6.3.0.02,6]undecan-10-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(1R,2R,6R,8R,10R)-3,7,9-trioxatricyclo[6.3.0.02,6]undecan-10-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 56929731 |
| Molecular Formula | C30H40N2O9S |
| Molecular Weight | 604.72 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | [(1R,2R,6R,8R,10R)-3,7,9-trioxatricyclo[6.3.0.02,6]undecan-10-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@@H]2C[C@H]3[C@@H](O2)O[C@@H]2CCO[C@H]32)cc1 |
| InChI | InChI=1S/C30H40N2O9S/c1-19(2)17-32(42(35,36)22-11-9-21(37-3)10-12-22)18-25(33)24(15-20-7-5-4-6-8-20)31-30(34)41-27-16-23-28-26(13-14-38-28)39-29(23)40-27/h4-12,19,23-29,33H,13-18H2,1-3H3,(H,31,34)/t23-,24+,25-,26-,27-,28-,29-/m1/s1 |
| InChIKey | LIWCXNOGMOCDFH-XTBUKPRSSA-N |
| XLogP | 2.92 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.72 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |