C31H42N2O9S — CID 73292867
[(1R,2R,6S,8S,12R)-5,7,10-trioxatricyclo[6.4.0.02,6]dodecan-12-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 73292867) has the molecular formula C31H42N2O9S and a molecular weight of 618.75 g/mol. Its IUPAC name is [(1R,2R,6S,8S,12R)-5,7,10-trioxatricyclo[6.4.0.02,6]dodecan-12-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(1R,2R,6S,8S,12R)-5,7,10-trioxatricyclo[6.4.0.02,6]dodecan-12-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 73292867 |
| Molecular Formula | C31H42N2O9S |
| Molecular Weight | 618.75 g/mol |
| Exact Mass | 618.26 |
| IUPAC Name | [(1R,2R,6S,8S,12R)-5,7,10-trioxatricyclo[6.4.0.02,6]dodecan-12-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2COC[C@H]3O[C@@H]4OCC[C@@H]4[C@@H]23)cc1 |
| InChI | InChI=1S/C31H42N2O9S/c1-20(2)16-33(43(36,37)23-11-9-22(38-3)10-12-23)17-26(34)25(15-21-7-5-4-6-8-21)32-31(35)42-28-19-39-18-27-29(28)24-13-14-40-30(24)41-27/h4-12,20,24-30,34H,13-19H2,1-3H3,(H,32,35)/t24-,25+,26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | ZFMLVULNQHLHJT-FVKXMQIMSA-N |
| XLogP | 2.82 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |