C26H30F3N3O9S — CID 58779183
[(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-[(2,2,2-trifluoroacetyl)amino]amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 58779183) has the molecular formula C26H30F3N3O9S and a molecular weight of 617.60 g/mol. Its IUPAC name is [(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-[(2,2,2-trifluoroacetyl)amino]amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-[(2,2,2-trifluoroacetyl)amino]amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58779183 |
| Molecular Formula | C26H30F3N3O9S |
| Molecular Weight | 617.60 g/mol |
| Exact Mass | 617.17 |
| IUPAC Name | [(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-[(2,2,2-trifluoroacetyl)amino]amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CO[C@H]3OCCC32)NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H30F3N3O9S/c1-38-17-7-9-18(10-8-17)42(36,37)32(31-24(34)26(27,28)29)14-21(33)20(13-16-5-3-2-4-6-16)30-25(35)41-22-15-40-23-19(22)11-12-39-23/h2-10,19-23,33H,11-15H2,1H3,(H,30,35)(H,31,34)/t19?,20-,21+,22-,23+/m0/s1 |
| InChIKey | HNOQWBZVKZOTNG-ARHMPVJQSA-N |
| XLogP | 1.74 |
| TPSA | 152.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.60 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|