C30H41N3O6 — CID 59090624
[(3R,3aS,7aR)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-3-yl] N-[4-[(3-aminophenyl)methyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59090624) has the molecular formula C30H41N3O6 and a molecular weight of 539.67 g/mol. Its IUPAC name is [(3R,3aS,7aR)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-3-yl] N-[4-[(3-aminophenyl)methyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3R,3aS,7aR)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-3-yl] N-[4-[(3-aminophenyl)methyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59090624 |
| Molecular Formula | C30H41N3O6 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | [(3R,3aS,7aR)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-3-yl] N-[4-[(3-aminophenyl)methyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | Nc1cccc(CN(CC(O)C(Cc2ccccc2)NC(=O)O[C@H]2CO[C@H]3OCCC[C@H]32)OC2CCCC2)c1 |
| InChI | InChI=1S/C30H41N3O6/c31-23-11-6-10-22(16-23)18-33(39-24-12-4-5-13-24)19-27(34)26(17-21-8-2-1-3-9-21)32-30(35)38-28-20-37-29-25(28)14-7-15-36-29/h1-3,6,8-11,16,24-29,34H,4-5,7,12-15,17-20,31H2,(H,32,35)/t25-,26?,27?,28-,29+/m0/s1 |
| InChIKey | OVOFJODZGOMEDO-QXUAYGSHSA-N |
| XLogP | 3.79 |
| TPSA | 115.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|