C28H38N2O7 — CID 59090690
1,3-dioxan-5-yl N-[(2S)-4-[cyclopentyloxy-[(4-methoxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59090690) has the molecular formula C28H38N2O7 and a molecular weight of 514.62 g/mol. Its IUPAC name is 1,3-dioxan-5-yl N-[(2S)-4-[cyclopentyloxy-[(4-methoxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 1,3-dioxan-5-yl N-[(2S)-4-[cyclopentyloxy-[(4-methoxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59090690 |
| Molecular Formula | C28H38N2O7 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 1,3-dioxan-5-yl N-[(2S)-4-[cyclopentyloxy-[(4-methoxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(CN(CC(O)[C@H](Cc2ccccc2)NC(=O)OC2COCOC2)OC2CCCC2)cc1 |
| InChI | InChI=1S/C28H38N2O7/c1-33-23-13-11-22(12-14-23)16-30(37-24-9-5-6-10-24)17-27(31)26(15-21-7-3-2-4-8-21)29-28(32)36-25-18-34-20-35-19-25/h2-4,7-8,11-14,24-27,31H,5-6,9-10,15-20H2,1H3,(H,29,32)/t26-,27?/m0/s1 |
| InChIKey | MZUCMYNOYUKOSL-QBHOUYDASA-N |
| XLogP | 3.44 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|