C21H25FN2O5 — CID 68799136
tert-butyl (2S,6E)-6-[2-(1,3-dioxoisoindol-2-yl)-1-fluoroethylidene]-2-methyl-1,4-oxazepane-4-carboxylate (PubChem CID 68799136) has the molecular formula C21H25FN2O5 and a molecular weight of 404.44 g/mol. Its IUPAC name is tert-butyl (2S,6E)-6-[2-(1,3-dioxoisoindol-2-yl)-1-fluoroethylidene]-2-methyl-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl (2S,6E)-6-[2-(1,3-dioxoisoindol-2-yl)-1-fluoroethylidene]-2-methyl-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 68799136 |
| Molecular Formula | C21H25FN2O5 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | tert-butyl (2S,6E)-6-[2-(1,3-dioxoisoindol-2-yl)-1-fluoroethylidene]-2-methyl-1,4-oxazepane-4-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)C/C(=C(\F)CN2C(=O)c3ccccc3C2=O)CO1 |
| InChI | InChI=1S/C21H25FN2O5/c1-13-9-23(20(27)29-21(2,3)4)10-14(12-28-13)17(22)11-24-18(25)15-7-5-6-8-16(15)19(24)26/h5-8,13H,9-12H2,1-4H3/b17-14+/t13-/m0/s1 |
| InChIKey | NEADIERLGPGRME-CQQXOOPHSA-N |
| XLogP | 3.16 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|