C21H27N3O5 — CID 139343824
tert-butyl 3-(dimethylamino)-5-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxopiperidine-1-carboxylate (PubChem CID 139343824) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is tert-butyl 3-(dimethylamino)-5-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(dimethylamino)-5-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 139343824 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | tert-butyl 3-(dimethylamino)-5-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxopiperidine-1-carboxylate |
| SMILES | CN(C)C1CN(C(=O)OC(C)(C)C)CC(CN2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C21H27N3O5/c1-21(2,3)29-20(28)23-10-13(17(25)16(12-23)22(4)5)11-24-18(26)14-8-6-7-9-15(14)19(24)27/h6-9,13,16H,10-12H2,1-5H3 |
| InChIKey | JUUJQIACRCDGMN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|