C21H29NO5S — CID 58894166
tert-butyl (4S,6S)-8-[(4-methylphenyl)sulfonyloxymethyl]-5-azatricyclo[4.3.0.01,4]nonane-5-carboxylate (PubChem CID 58894166) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is tert-butyl (4S,6S)-8-[(4-methylphenyl)sulfonyloxymethyl]-5-azatricyclo[4.3.0.01,4]nonane-5-carboxylate.
| Compound Name | tert-butyl (4S,6S)-8-[(4-methylphenyl)sulfonyloxymethyl]-5-azatricyclo[4.3.0.01,4]nonane-5-carboxylate |
|---|---|
| PubChem CID | 58894166 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | tert-butyl (4S,6S)-8-[(4-methylphenyl)sulfonyloxymethyl]-5-azatricyclo[4.3.0.01,4]nonane-5-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2C[C@@H]3N(C(=O)OC(C)(C)C)[C@H]4CCC43C2)cc1 |
| InChI | InChI=1S/C21H29NO5S/c1-14-5-7-16(8-6-14)28(24,25)26-13-15-11-18-21(12-15)10-9-17(21)22(18)19(23)27-20(2,3)4/h5-8,15,17-18H,9-13H2,1-4H3/t15?,17-,18-,21?/m0/s1 |
| InChIKey | XZWWSBGIHZANOJ-JJQSQXROSA-N |
| XLogP | 3.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|