C18H37NO6SSi — CID 168948559
tert-butyl (2S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 168948559) has the molecular formula C18H37NO6SSi and a molecular weight of 423.65 g/mol. Its IUPAC name is tert-butyl (2S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168948559 |
| Molecular Formula | C18H37NO6SSi |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | tert-butyl (2S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | C[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H](COS(C)(=O)=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H37NO6SSi/c1-13-15(25-27(9,10)18(5,6)7)11-14(12-23-26(8,21)22)19(13)16(20)24-17(2,3)4/h13-15H,11-12H2,1-10H3/t13-,14-,15+/m0/s1 |
| InChIKey | NJGXGLCHRALINR-SOUVJXGZSA-N |
| XLogP | 3.75 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|