C13H23F2NO5S — CID 170987946
tert-butyl 2-(1,1-difluoroethylsulfonyloxymethyl)piperidine-1-carboxylate (PubChem CID 170987946) has the molecular formula C13H23F2NO5S and a molecular weight of 343.39 g/mol. Its IUPAC name is tert-butyl 2-(1,1-difluoroethylsulfonyloxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(1,1-difluoroethylsulfonyloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170987946 |
| Molecular Formula | C13H23F2NO5S |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | tert-butyl 2-(1,1-difluoroethylsulfonyloxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1COS(=O)(=O)C(C)(F)F |
| InChI | InChI=1S/C13H23F2NO5S/c1-12(2,3)21-11(17)16-8-6-5-7-10(16)9-20-22(18,19)13(4,14)15/h10H,5-9H2,1-4H3 |
| InChIKey | FSHZYEMRNSVKDH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|