C16H24F2N4O4 — CID 90228989
(2S)-6-butoxy-N'-(3,3-difluorocyclobutanecarbonyl)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide (PubChem CID 90228989) has the molecular formula C16H24F2N4O4 and a molecular weight of 374.39 g/mol. Its IUPAC name is (2S)-6-butoxy-N'-(3,3-difluorocyclobutanecarbonyl)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide.
| Compound Name | (2S)-6-butoxy-N'-(3,3-difluorocyclobutanecarbonyl)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide |
|---|---|
| PubChem CID | 90228989 |
| Molecular Formula | C16H24F2N4O4 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (2S)-6-butoxy-N'-(3,3-difluorocyclobutanecarbonyl)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide |
| SMILES | CCCCON1C(=O)N2CC1CC[C@H]2C(=O)NNC(=O)C1CC(F)(F)C1 |
| InChI | InChI=1S/C16H24F2N4O4/c1-2-3-6-26-22-11-4-5-12(21(9-11)15(22)25)14(24)20-19-13(23)10-7-16(17,18)8-10/h10-12H,2-9H2,1H3,(H,19,23)(H,20,24)/t11?,12-/m0/s1 |
| InChIKey | UXBPUBZFSGLQFT-KIYNQFGBSA-N |
| XLogP | 1.18 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|